C10H18O3 — CID 101472171
(1R,2S,5S,6R)-2-ethyl-5,6-bis(hydroxymethyl)cyclohex-3-en-1-ol (PubChem CID 101472171) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is (1R,2S,5S,6R)-2-ethyl-5,6-bis(hydroxymethyl)cyclohex-3-en-1-ol.
| Compound Name | (1R,2S,5S,6R)-2-ethyl-5,6-bis(hydroxymethyl)cyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 101472171 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (1R,2S,5S,6R)-2-ethyl-5,6-bis(hydroxymethyl)cyclohex-3-en-1-ol |
| SMILES | CC[C@H]1C=C[C@H](CO)[C@H](CO)[C@@H]1O |
| InChI | InChI=1S/C10H18O3/c1-2-7-3-4-8(5-11)9(6-12)10(7)13/h3-4,7-13H,2,5-6H2,1H3/t7-,8+,9-,10+/m0/s1 |
| InChIKey | QPFRRMHWBCHBEK-QCLAVDOMSA-N |
| XLogP | 0.16 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|