C24H20N2O2S2 — CID 101472894
N,N'-bis(4-methoxyphenyl)-1,2-dithiophen-2-ylethane-1,2-diimine (PubChem CID 101472894) has the molecular formula C24H20N2O2S2 and a molecular weight of 432.57 g/mol. Its IUPAC name is N,N'-bis(4-methoxyphenyl)-1,2-dithiophen-2-ylethane-1,2-diimine.
| Compound Name | N,N'-bis(4-methoxyphenyl)-1,2-dithiophen-2-ylethane-1,2-diimine |
|---|---|
| PubChem CID | 101472894 |
| Molecular Formula | C24H20N2O2S2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | N,N'-bis(4-methoxyphenyl)-1,2-dithiophen-2-ylethane-1,2-diimine |
| SMILES | COc1ccc(/N=C(C(=N\c2ccc(OC)cc2)/c2cccs2)\c2cccs2)cc1 |
| InChI | InChI=1S/C24H20N2O2S2/c1-27-19-11-7-17(8-12-19)25-23(21-5-3-15-29-21)24(22-6-4-16-30-22)26-18-9-13-20(28-2)14-10-18/h3-16H,1-2H3/b25-23-,26-24+ |
| InChIKey | NTESSYSEJWOCKC-MJPLYFDISA-N |
| XLogP | 6.77 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|