C23H40OSi2 — CID 101474219
[(1E)-1-(2,2-ditert-butyl-5-methyl-5-phenyloxasilolan-4-ylidene)ethyl]-trimethylsilane (PubChem CID 101474219) has the molecular formula C23H40OSi2 and a molecular weight of 388.74 g/mol. Its IUPAC name is [(1E)-1-(2,2-ditert-butyl-5-methyl-5-phenyloxasilolan-4-ylidene)ethyl]-trimethylsilane.
| Compound Name | [(1E)-1-(2,2-ditert-butyl-5-methyl-5-phenyloxasilolan-4-ylidene)ethyl]-trimethylsilane |
|---|---|
| PubChem CID | 101474219 |
| Molecular Formula | C23H40OSi2 |
| Molecular Weight | 388.74 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | [(1E)-1-(2,2-ditert-butyl-5-methyl-5-phenyloxasilolan-4-ylidene)ethyl]-trimethylsilane |
| SMILES | C/C(=C1\C[Si](C(C)(C)C)(C(C)(C)C)OC1(C)c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C23H40OSi2/c1-18(25(9,10)11)20-17-26(21(2,3)4,22(5,6)7)24-23(20,8)19-15-13-12-14-16-19/h12-16H,17H2,1-11H3/b20-18- |
| InChIKey | WOLQLVVRFGFYNO-ZZEZOPTASA-N |
| XLogP | 7.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.74 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|