C16H23NO3 — CID 101476302
(7S,8R,10S,12S,14S)-8-hydroxy-14-methyl-3-azatetracyclo[9.3.1.03,12.07,12]pentadec-11(15)-ene-10-carboxylic acid (PubChem CID 101476302) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is (7S,8R,10S,12S,14S)-8-hydroxy-14-methyl-3-azatetracyclo[9.3.1.03,12.07,12]pentadec-11(15)-ene-10-carboxylic acid.
| Compound Name | (7S,8R,10S,12S,14S)-8-hydroxy-14-methyl-3-azatetracyclo[9.3.1.03,12.07,12]pentadec-11(15)-ene-10-carboxylic acid |
|---|---|
| PubChem CID | 101476302 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | (7S,8R,10S,12S,14S)-8-hydroxy-14-methyl-3-azatetracyclo[9.3.1.03,12.07,12]pentadec-11(15)-ene-10-carboxylic acid |
| SMILES | C[C@H]1C[C@]23C4=CC1CN2CCC[C@@H]3[C@H](O)C[C@@H]4C(=O)O |
| InChI | InChI=1S/C16H23NO3/c1-9-7-16-12-3-2-4-17(16)8-10(9)5-13(16)11(15(19)20)6-14(12)18/h5,9-12,14,18H,2-4,6-8H2,1H3,(H,19,20)/t9-,10?,11-,12+,14+,16-/m0/s1 |
| InChIKey | PBWADGLOXCLHLK-OQHOUTLYSA-N |
| XLogP | 1.50 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|