C11H15NO — CID 101477346
(2E,4E)-5-[bis(prop-2-enyl)amino]penta-2,4-dienal (PubChem CID 101477346) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is (2E,4E)-5-[bis(prop-2-enyl)amino]penta-2,4-dienal.
| Compound Name | (2E,4E)-5-[bis(prop-2-enyl)amino]penta-2,4-dienal |
|---|---|
| PubChem CID | 101477346 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | (2E,4E)-5-[bis(prop-2-enyl)amino]penta-2,4-dienal |
| SMILES | C=CCN(/C=C/C=C/C=O)CC=C |
| InChI | InChI=1S/C11H15NO/c1-3-8-12(9-4-2)10-6-5-7-11-13/h3-7,10-11H,1-2,8-9H2/b7-5+,10-6+ |
| InChIKey | JPPCKMPRMAYNGR-YLNKAEQOSA-N |
| XLogP | 1.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|