C22H23NO4 — CID 101478832
ethyl (2R,3R)-1-[(E)-4-oxo-4-phenylmethoxybut-2-en-2-yl]-3-phenylaziridine-2-carboxylate (PubChem CID 101478832) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is ethyl (2R,3R)-1-[(E)-4-oxo-4-phenylmethoxybut-2-en-2-yl]-3-phenylaziridine-2-carboxylate.
| Compound Name | ethyl (2R,3R)-1-[(E)-4-oxo-4-phenylmethoxybut-2-en-2-yl]-3-phenylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 101478832 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | ethyl (2R,3R)-1-[(E)-4-oxo-4-phenylmethoxybut-2-en-2-yl]-3-phenylaziridine-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H](c2ccccc2)N1/C(C)=C/C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H23NO4/c1-3-26-22(25)21-20(18-12-8-5-9-13-18)23(21)16(2)14-19(24)27-15-17-10-6-4-7-11-17/h4-14,20-21H,3,15H2,1-2H3/b16-14+/t20-,21-,23?/m1/s1 |
| InChIKey | FBPQSCAPWASVGY-QWUKVFJSSA-N |
| XLogP | 3.62 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|