C21H12O4S14 — CID 101479801
dimethyl 2-[2-[4-[[2-(1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]sulfanylmethylsulfanyl]-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-5-ylidene]-1,3-dithiole-4,5-dicarboxylate (PubChem CID 101479801) has the molecular formula C21H12O4S14 and a molecular weight of 777.26 g/mol. Its IUPAC name is dimethyl 2-[2-[4-[[2-(1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]sulfanylmethylsulfanyl]-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-5-ylidene]-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-[2-[4-[[2-(1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]sulfanylmethylsulfanyl]-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-5-ylidene]-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 101479801 |
| Molecular Formula | C21H12O4S14 |
| Molecular Weight | 777.26 g/mol |
| Exact Mass | 775.68 |
| IUPAC Name | dimethyl 2-[2-[4-[[2-(1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]sulfanylmethylsulfanyl]-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-5-ylidene]-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=C2SC3=C(SC(=C4SC=C(SCSC5=CSC(=C6SC=CS6)S5)S4)S3)S2)S1 |
| InChI | InChI=1S/C21H12O4S14/c1-24-12(22)10-11(13(23)25-2)35-18(34-10)19-38-20-21(39-19)37-17(36-20)16-29-6-9(33-16)31-7-30-8-5-28-15(32-8)14-26-3-4-27-14/h3-6H,7H2,1-2H3 |
| InChIKey | ONSVXQRQRFGUNF-UHFFFAOYSA-N |
| XLogP | 11.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.26 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|