C11H15IO3 — CID 101482677
(3aS,7aS)-7a-ethyl-5-iodo-2,2-dimethyl-3a,7-dihydro-1,3-benzodioxol-4-one (PubChem CID 101482677) has the molecular formula C11H15IO3 and a molecular weight of 322.14 g/mol. Its IUPAC name is (3aS,7aS)-7a-ethyl-5-iodo-2,2-dimethyl-3a,7-dihydro-1,3-benzodioxol-4-one.
| Compound Name | (3aS,7aS)-7a-ethyl-5-iodo-2,2-dimethyl-3a,7-dihydro-1,3-benzodioxol-4-one |
|---|---|
| PubChem CID | 101482677 |
| Molecular Formula | C11H15IO3 |
| Molecular Weight | 322.14 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | (3aS,7aS)-7a-ethyl-5-iodo-2,2-dimethyl-3a,7-dihydro-1,3-benzodioxol-4-one |
| SMILES | CC[C@]12CC=C(I)C(=O)[C@H]1OC(C)(C)O2 |
| InChI | InChI=1S/C11H15IO3/c1-4-11-6-5-7(12)8(13)9(11)14-10(2,3)15-11/h5,9H,4,6H2,1-3H3/t9-,11+/m1/s1 |
| InChIKey | ZPRXXXKEOMUEFG-KOLCDFICSA-N |
| XLogP | 2.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.14 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|