C12H17IO5 — CID 134857084
(5S)-3-iodo-7,8-dimethoxy-7,8-dimethyl-6,9-dioxaspiro[4.5]dec-2-en-4-one (PubChem CID 134857084) has the molecular formula C12H17IO5 and a molecular weight of 368.17 g/mol. Its IUPAC name is (5S)-3-iodo-7,8-dimethoxy-7,8-dimethyl-6,9-dioxaspiro[4.5]dec-2-en-4-one.
| Compound Name | (5S)-3-iodo-7,8-dimethoxy-7,8-dimethyl-6,9-dioxaspiro[4.5]dec-2-en-4-one |
|---|---|
| PubChem CID | 134857084 |
| Molecular Formula | C12H17IO5 |
| Molecular Weight | 368.17 g/mol |
| Exact Mass | 368.01 |
| IUPAC Name | (5S)-3-iodo-7,8-dimethoxy-7,8-dimethyl-6,9-dioxaspiro[4.5]dec-2-en-4-one |
| SMILES | COC1(C)OC[C@]2(CC=C(I)C2=O)OC1(C)OC |
| InChI | InChI=1S/C12H17IO5/c1-10(15-3)11(2,16-4)18-12(7-17-10)6-5-8(13)9(12)14/h5H,6-7H2,1-4H3/t10?,11?,12-/m0/s1 |
| InChIKey | TYAUPHSNLRWTLT-MCIGGMRASA-N |
| XLogP | 1.79 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.17 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|