C24H50O5Si4 — CID 101486299
ethyl (2S,3R,4R)-4-tert-butyl-3-[(E)-3-ethoxy-3-oxoprop-1-enyl]-1,1-bis(trimethylsilyl)-4-trimethylsilyloxysiletane-2-carboxylate (PubChem CID 101486299) has the molecular formula C24H50O5Si4 and a molecular weight of 531.00 g/mol. Its IUPAC name is ethyl (2S,3R,4R)-4-tert-butyl-3-[(E)-3-ethoxy-3-oxoprop-1-enyl]-1,1-bis(trimethylsilyl)-4-trimethylsilyloxysiletane-2-carboxylate.
| Compound Name | ethyl (2S,3R,4R)-4-tert-butyl-3-[(E)-3-ethoxy-3-oxoprop-1-enyl]-1,1-bis(trimethylsilyl)-4-trimethylsilyloxysiletane-2-carboxylate |
|---|---|
| PubChem CID | 101486299 |
| Molecular Formula | C24H50O5Si4 |
| Molecular Weight | 531.00 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | ethyl (2S,3R,4R)-4-tert-butyl-3-[(E)-3-ethoxy-3-oxoprop-1-enyl]-1,1-bis(trimethylsilyl)-4-trimethylsilyloxysiletane-2-carboxylate |
| SMILES | CCOC(=O)/C=C/[C@@H]1[C@@H](C(=O)OCC)[Si]([Si](C)(C)C)([Si](C)(C)C)[C@@]1(O[Si](C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C24H50O5Si4/c1-15-27-20(25)18-17-19-21(22(26)28-16-2)33(31(9,10)11,32(12,13)14)24(19,23(3,4)5)29-30(6,7)8/h17-19,21H,15-16H2,1-14H3/b18-17+/t19-,21+,24-/m1/s1 |
| InChIKey | OKQIPQQHLBMIJW-CUMMRIQHSA-N |
| XLogP | 6.13 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.00 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|