C23H48O5Si4 — CID 177423218
methyl (4R)-4-tert-butyl-3-(3-ethoxy-3-oxoprop-1-enyl)-1,1-bis(trimethylsilyl)-4-trimethylsilyloxysiletane-2-carboxylate (PubChem CID 177423218) has the molecular formula C23H48O5Si4 and a molecular weight of 516.98 g/mol. Its IUPAC name is methyl (4R)-4-tert-butyl-3-(3-ethoxy-3-oxoprop-1-enyl)-1,1-bis(trimethylsilyl)-4-trimethylsilyloxysiletane-2-carboxylate.
| Compound Name | methyl (4R)-4-tert-butyl-3-(3-ethoxy-3-oxoprop-1-enyl)-1,1-bis(trimethylsilyl)-4-trimethylsilyloxysiletane-2-carboxylate |
|---|---|
| PubChem CID | 177423218 |
| Molecular Formula | C23H48O5Si4 |
| Molecular Weight | 516.98 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | methyl (4R)-4-tert-butyl-3-(3-ethoxy-3-oxoprop-1-enyl)-1,1-bis(trimethylsilyl)-4-trimethylsilyloxysiletane-2-carboxylate |
| SMILES | CCOC(=O)C=CC1C(C(=O)OC)[Si]([Si](C)(C)C)([Si](C)(C)C)[C@@]1(O[Si](C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C23H48O5Si4/c1-15-27-19(24)17-16-18-20(21(25)26-5)32(30(9,10)11,31(12,13)14)23(18,22(2,3)4)28-29(6,7)8/h16-18,20H,15H2,1-14H3/t18?,20?,23-/m1/s1 |
| InChIKey | ABFVFHYJZFJKLL-KXNZUKPASA-N |
| XLogP | 5.74 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.98 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|