C19H34S2 — CID 101486575
2-cyclopentadecylidene-1,3-dithiane (PubChem CID 101486575) has the molecular formula C19H34S2 and a molecular weight of 326.62 g/mol. Its IUPAC name is 2-cyclopentadecylidene-1,3-dithiane.
| Compound Name | 2-cyclopentadecylidene-1,3-dithiane |
|---|---|
| PubChem CID | 101486575 |
| Molecular Formula | C19H34S2 |
| Molecular Weight | 326.62 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 2-cyclopentadecylidene-1,3-dithiane |
| SMILES | C1CCCCCCCC(=C2SCCCS2)CCCCCC1 |
| InChI | InChI=1S/C19H34S2/c1-2-4-6-8-10-12-15-18(14-11-9-7-5-3-1)19-20-16-13-17-21-19/h1-17H2 |
| InChIKey | GVENIODGSWKVES-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.62 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |