C20H33+ — CID 101486972
(3aR,5E)-3a,6,10-trimethyl-1-propan-2-yl-2,3,4,7,8,9,11,12-octahydrocyclopenta[11]annulen-10-ylium (PubChem CID 101486972) has the molecular formula C20H33+ and a molecular weight of 273.48 g/mol. Its IUPAC name is (3aR,5E)-3a,6,10-trimethyl-1-propan-2-yl-2,3,4,7,8,9,11,12-octahydrocyclopenta[11]annulen-10-ylium.
| Compound Name | (3aR,5E)-3a,6,10-trimethyl-1-propan-2-yl-2,3,4,7,8,9,11,12-octahydrocyclopenta[11]annulen-10-ylium |
|---|---|
| PubChem CID | 101486972 |
| Molecular Formula | C20H33+ |
| Molecular Weight | 273.48 g/mol |
| Exact Mass | 273.26 |
| IUPAC Name | (3aR,5E)-3a,6,10-trimethyl-1-propan-2-yl-2,3,4,7,8,9,11,12-octahydrocyclopenta[11]annulen-10-ylium |
| SMILES | C/C1=C\C[C@@]2(C)CCC(C(C)C)=C2CC[C+](C)CCC1 |
| InChI | InChI=1S/C20H33/c1-15(2)18-12-14-20(5)13-11-17(4)8-6-7-16(3)9-10-19(18)20/h11,15H,6-10,12-14H2,1-5H3/q+1/b17-11+/t20-/m0/s1 |
| InChIKey | IOUXUFMGEHFGBO-KDMTZKAISA-N |
| XLogP | 6.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.48 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|