C21H34O2 — CID 170982207
(11S)-14-(methoxymethyl)-3,10-dimethyl-6-propan-2-yltricyclo[9.3.0.03,7]tetradeca-1(14),6-dien-9-ol (PubChem CID 170982207) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is (11S)-14-(methoxymethyl)-3,10-dimethyl-6-propan-2-yltricyclo[9.3.0.03,7]tetradeca-1(14),6-dien-9-ol.
| Compound Name | (11S)-14-(methoxymethyl)-3,10-dimethyl-6-propan-2-yltricyclo[9.3.0.03,7]tetradeca-1(14),6-dien-9-ol |
|---|---|
| PubChem CID | 170982207 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | (11S)-14-(methoxymethyl)-3,10-dimethyl-6-propan-2-yltricyclo[9.3.0.03,7]tetradeca-1(14),6-dien-9-ol |
| SMILES | COCC1=C2CC3(C)CCC(C(C)C)=C3CC(O)C(C)[C@@H]2CC1 |
| InChI | InChI=1S/C21H34O2/c1-13(2)16-8-9-21(4)11-18-15(12-23-5)6-7-17(18)14(3)20(22)10-19(16)21/h13-14,17,20,22H,6-12H2,1-5H3/t14?,17-,20?,21?/m0/s1 |
| InChIKey | PABGASFQYUYTLP-PCDXGBFMSA-N |
| XLogP | 4.88 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|