C24H44O — CID 170982226
ethane;1-(methoxymethyl)-4,8a-dimethyl-6-propan-2-yl-2,3,3a,4,6,7,8,9-octahydrocyclopenta[f]azulene (PubChem CID 170982226) has the molecular formula C24H44O and a molecular weight of 348.62 g/mol. Its IUPAC name is ethane;1-(methoxymethyl)-4,8a-dimethyl-6-propan-2-yl-2,3,3a,4,6,7,8,9-octahydrocyclopenta[f]azulene.
| Compound Name | ethane;1-(methoxymethyl)-4,8a-dimethyl-6-propan-2-yl-2,3,3a,4,6,7,8,9-octahydrocyclopenta[f]azulene |
|---|---|
| PubChem CID | 170982226 |
| Molecular Formula | C24H44O |
| Molecular Weight | 348.62 g/mol |
| Exact Mass | 348.34 |
| IUPAC Name | ethane;1-(methoxymethyl)-4,8a-dimethyl-6-propan-2-yl-2,3,3a,4,6,7,8,9-octahydrocyclopenta[f]azulene |
| SMILES | CC.CC.COCC1=C2CC3(C)CCC(C(C)C)C3=CC(C)C2CC1 |
| InChI | InChI=1S/C20H32O.2C2H6/c1-13(2)16-8-9-20(4)11-18-15(12-21-5)6-7-17(18)14(3)10-19(16)20;2*1-2/h10,13-14,16-17H,6-9,11-12H2,1-5H3;2*1-2H3 |
| InChIKey | KOLBNUGJGVHWLY-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.62 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|