C22H36O4 — CID 146682185
[(1R,3R,4R,6R,7S,8S,10Z,12R)-6,8-dihydroxy-1,8-dimethyl-12-propan-2-yl-4-tricyclo[9.3.0.03,7]tetradec-10-enyl]methyl acetate (PubChem CID 146682185) has the molecular formula C22H36O4 and a molecular weight of 364.53 g/mol. Its IUPAC name is [(1R,3R,4R,6R,7S,8S,10Z,12R)-6,8-dihydroxy-1,8-dimethyl-12-propan-2-yl-4-tricyclo[9.3.0.03,7]tetradec-10-enyl]methyl acetate.
| Compound Name | [(1R,3R,4R,6R,7S,8S,10Z,12R)-6,8-dihydroxy-1,8-dimethyl-12-propan-2-yl-4-tricyclo[9.3.0.03,7]tetradec-10-enyl]methyl acetate |
|---|---|
| PubChem CID | 146682185 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | [(1R,3R,4R,6R,7S,8S,10Z,12R)-6,8-dihydroxy-1,8-dimethyl-12-propan-2-yl-4-tricyclo[9.3.0.03,7]tetradec-10-enyl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1C[C@@H](O)[C@@H]2[C@@H]1C[C@@]1(C)CC[C@H](C(C)C)/C1=C/C[C@]2(C)O |
| InChI | InChI=1S/C22H36O4/c1-13(2)16-6-8-21(4)11-17-15(12-26-14(3)23)10-19(24)20(17)22(5,25)9-7-18(16)21/h7,13,15-17,19-20,24-25H,6,8-12H2,1-5H3/b18-7-/t15-,16+,17+,19+,20-,21+,22-/m0/s1 |
| InChIKey | IGDSFDJTJMVTDM-KBSBJJLISA-N |
| XLogP | 3.71 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|