C22H34O4 — CID 70421981
[(3S,8R,9S,10R,13S,14R,15S,17S)-3,17-dihydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-15-yl]methyl acetate (PubChem CID 70421981) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is [(3S,8R,9S,10R,13S,14R,15S,17S)-3,17-dihydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-15-yl]methyl acetate.
| Compound Name | [(3S,8R,9S,10R,13S,14R,15S,17S)-3,17-dihydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-15-yl]methyl acetate |
|---|---|
| PubChem CID | 70421981 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | [(3S,8R,9S,10R,13S,14R,15S,17S)-3,17-dihydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-15-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1C[C@H](O)[C@@]2(C)CC[C@H]3[C@@H](CC=C4C[C@@H](O)CC[C@@]43C)[C@H]12 |
| InChI | InChI=1S/C22H34O4/c1-13(23)26-12-14-10-19(25)22(3)9-7-18-17(20(14)22)5-4-15-11-16(24)6-8-21(15,18)2/h4,14,16-20,24-25H,5-12H2,1-3H3/t14-,16+,17-,18+,19+,20+,21+,22-/m1/s1 |
| InChIKey | ZWVUHGBXAUTFOM-VUNMFWAWSA-N |
| XLogP | 3.46 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|