C20H29NO2 — CID 14234134
(3S,8R,9S,10R,13S,14R,15R,17S)-3,17-dihydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-15-carbonitrile (PubChem CID 14234134) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is (3S,8R,9S,10R,13S,14R,15R,17S)-3,17-dihydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-15-carbonitrile.
| Compound Name | (3S,8R,9S,10R,13S,14R,15R,17S)-3,17-dihydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-15-carbonitrile |
|---|---|
| PubChem CID | 14234134 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | (3S,8R,9S,10R,13S,14R,15R,17S)-3,17-dihydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-15-carbonitrile |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC=C4C[C@@H](O)CC[C@@]43C)[C@@H]1[C@H](C#N)C[C@@H]2O |
| InChI | InChI=1S/C20H29NO2/c1-19-7-5-14(22)10-13(19)3-4-15-16(19)6-8-20(2)17(23)9-12(11-21)18(15)20/h3,12,14-18,22-23H,4-10H2,1-2H3/t12-,14-,15+,16-,17-,18-,19-,20+/m0/s1 |
| InChIKey | ACTAGPUFYKUNBZ-QSYSCANKSA-N |
| XLogP | 3.42 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|