C24H35BrO6 — CID 22832355
[2-[(1S,5R,7S,8S,10R,11R,14R,15S)-15-acetyloxy-8,11-dihydroxy-1,5-dimethyl-5-tetracyclo[8.6.0.02,7.011,14]hexadec-2-enyl]-2-bromoethyl] acetate (PubChem CID 22832355) has the molecular formula C24H35BrO6 and a molecular weight of 499.44 g/mol. Its IUPAC name is [2-[(1S,5R,7S,8S,10R,11R,14R,15S)-15-acetyloxy-8,11-dihydroxy-1,5-dimethyl-5-tetracyclo[8.6.0.02,7.011,14]hexadec-2-enyl]-2-bromoethyl] acetate.
| Compound Name | [2-[(1S,5R,7S,8S,10R,11R,14R,15S)-15-acetyloxy-8,11-dihydroxy-1,5-dimethyl-5-tetracyclo[8.6.0.02,7.011,14]hexadec-2-enyl]-2-bromoethyl] acetate |
|---|---|
| PubChem CID | 22832355 |
| Molecular Formula | C24H35BrO6 |
| Molecular Weight | 499.44 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | [2-[(1S,5R,7S,8S,10R,11R,14R,15S)-15-acetyloxy-8,11-dihydroxy-1,5-dimethyl-5-tetracyclo[8.6.0.02,7.011,14]hexadec-2-enyl]-2-bromoethyl] acetate |
| SMILES | CC(=O)OCC(Br)[C@]1(C)CC=C2[C@H](C1)[C@@H](O)C[C@H]1[C@]3(O)CC[C@@H]3[C@@H](OC(C)=O)C[C@]21C |
| InChI | InChI=1S/C24H35BrO6/c1-13(26)30-12-21(25)22(3)7-5-16-15(10-22)18(28)9-20-23(16,4)11-19(31-14(2)27)17-6-8-24(17,20)29/h5,15,17-21,28-29H,6-12H2,1-4H3/t15-,17+,18-,19-,20+,21?,22+,23+,24-/m0/s1 |
| InChIKey | WPIOQMPNSKHZNV-JQQBIPPLSA-N |
| XLogP | 3.52 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|