C26H36O5 — CID 134922818
[(3S,6S,10S,13S,17E)-6-acetyloxy-10,13-dimethyl-17-(1-oxopropan-2-ylidene)-1,2,3,4,5,6,7,8,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 134922818) has the molecular formula C26H36O5 and a molecular weight of 428.57 g/mol. Its IUPAC name is [(3S,6S,10S,13S,17E)-6-acetyloxy-10,13-dimethyl-17-(1-oxopropan-2-ylidene)-1,2,3,4,5,6,7,8,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,6S,10S,13S,17E)-6-acetyloxy-10,13-dimethyl-17-(1-oxopropan-2-ylidene)-1,2,3,4,5,6,7,8,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 134922818 |
| Molecular Formula | C26H36O5 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | [(3S,6S,10S,13S,17E)-6-acetyloxy-10,13-dimethyl-17-(1-oxopropan-2-ylidene)-1,2,3,4,5,6,7,8,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@]2(C)C3=CC[C@]4(C)/C(=C(\C)C=O)CCC4C3C[C@H](OC(C)=O)C2C1 |
| InChI | InChI=1S/C26H36O5/c1-15(14-27)20-6-7-21-19-13-24(31-17(3)29)23-12-18(30-16(2)28)8-10-26(23,5)22(19)9-11-25(20,21)4/h9,14,18-19,21,23-24H,6-8,10-13H2,1-5H3/b20-15+/t18-,19?,21?,23?,24-,25+,26+/m0/s1 |
| InChIKey | BLAIFIBSMZEGTA-IXFFZLMTSA-N |
| XLogP | 4.94 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|