C28H40O5 — CID 87277334
[(3R,5S,7R,10S,13S)-7-acetyloxy-10,13-dimethyl-17-[(2R)-5-oxopentan-2-yl]-2,3,4,5,6,7,8,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 87277334) has the molecular formula C28H40O5 and a molecular weight of 456.62 g/mol. Its IUPAC name is [(3R,5S,7R,10S,13S)-7-acetyloxy-10,13-dimethyl-17-[(2R)-5-oxopentan-2-yl]-2,3,4,5,6,7,8,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3R,5S,7R,10S,13S)-7-acetyloxy-10,13-dimethyl-17-[(2R)-5-oxopentan-2-yl]-2,3,4,5,6,7,8,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 87277334 |
| Molecular Formula | C28H40O5 |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | [(3R,5S,7R,10S,13S)-7-acetyloxy-10,13-dimethyl-17-[(2R)-5-oxopentan-2-yl]-2,3,4,5,6,7,8,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@]2(C)C3=CC[C@]4(C)C([C@H](C)CCC=O)=CCC4C3[C@H](OC(C)=O)C[C@@H]2C1 |
| InChI | InChI=1S/C28H40O5/c1-17(7-6-14-29)22-8-9-23-26-24(11-13-28(22,23)5)27(4)12-10-21(32-18(2)30)15-20(27)16-25(26)33-19(3)31/h8,11,14,17,20-21,23,25-26H,6-7,9-10,12-13,15-16H2,1-5H3/t17-,20+,21-,23?,25-,26?,27+,28-/m1/s1 |
| InChIKey | OSLMDXQOKYSUJE-XSOQCSQSSA-N |
| XLogP | 5.57 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|