C29H42O7 — CID 144713980
methyl (4R)-4-[(3R,7R,14S)-3,7-diacetyloxy-10,13-dimethyl-15-oxo-1,2,3,4,5,6,7,8,9,11,12,14-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 144713980) has the molecular formula C29H42O7 and a molecular weight of 502.65 g/mol. Its IUPAC name is methyl (4R)-4-[(3R,7R,14S)-3,7-diacetyloxy-10,13-dimethyl-15-oxo-1,2,3,4,5,6,7,8,9,11,12,14-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl (4R)-4-[(3R,7R,14S)-3,7-diacetyloxy-10,13-dimethyl-15-oxo-1,2,3,4,5,6,7,8,9,11,12,14-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 144713980 |
| Molecular Formula | C29H42O7 |
| Molecular Weight | 502.65 g/mol |
| Exact Mass | 502.29 |
| IUPAC Name | methyl (4R)-4-[(3R,7R,14S)-3,7-diacetyloxy-10,13-dimethyl-15-oxo-1,2,3,4,5,6,7,8,9,11,12,14-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COC(=O)CC[C@@H](C)C1=CC(=O)[C@H]2C3C(OC(C)=O)CC4C[C@H](OC(C)=O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C29H42O7/c1-16(7-8-25(33)34-6)22-15-23(32)27-26-21(10-12-29(22,27)5)28(4)11-9-20(35-17(2)30)13-19(28)14-24(26)36-18(3)31/h15-16,19-21,24,26-27H,7-14H2,1-6H3/t16-,19?,20-,21?,24?,26?,27+,28?,29?/m1/s1 |
| InChIKey | IGKDTWGLOVLEJC-FJYOIJNGSA-N |
| XLogP | 4.81 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.65 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|