C30H46O4 — CID 10895995
[(2R)-2-[(1S,3R)-3-[(R)-methoxy-[(5S)-2-(methoxymethoxymethyl)-5-propan-2-ylcyclopenten-1-yl]methyl]-3-methyl-2-methylidenecyclopentyl]propoxy]methylbenzene (PubChem CID 10895995) has the molecular formula C30H46O4 and a molecular weight of 470.69 g/mol. Its IUPAC name is [(2R)-2-[(1S,3R)-3-[(R)-methoxy-[(5S)-2-(methoxymethoxymethyl)-5-propan-2-ylcyclopenten-1-yl]methyl]-3-methyl-2-methylidenecyclopentyl]propoxy]methylbenzene.
| Compound Name | [(2R)-2-[(1S,3R)-3-[(R)-methoxy-[(5S)-2-(methoxymethoxymethyl)-5-propan-2-ylcyclopenten-1-yl]methyl]-3-methyl-2-methylidenecyclopentyl]propoxy]methylbenzene |
|---|---|
| PubChem CID | 10895995 |
| Molecular Formula | C30H46O4 |
| Molecular Weight | 470.69 g/mol |
| Exact Mass | 470.34 |
| IUPAC Name | [(2R)-2-[(1S,3R)-3-[(R)-methoxy-[(5S)-2-(methoxymethoxymethyl)-5-propan-2-ylcyclopenten-1-yl]methyl]-3-methyl-2-methylidenecyclopentyl]propoxy]methylbenzene |
| SMILES | C=C1[C@H]([C@@H](C)COCc2ccccc2)CC[C@@]1(C)[C@@H](OC)C1=C(COCOC)CC[C@H]1C(C)C |
| InChI | InChI=1S/C30H46O4/c1-21(2)26-14-13-25(19-34-20-31-6)28(26)29(32-7)30(5)16-15-27(23(30)4)22(3)17-33-18-24-11-9-8-10-12-24/h8-12,21-22,26-27,29H,4,13-20H2,1-3,5-7H3/t22-,26-,27-,29-,30+/m0/s1 |
| InChIKey | VMQFPFMDYJRQQU-CTBCRKBJSA-N |
| XLogP | 6.81 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.69 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|