C13H21NO2 — CID 123394130
1-methoxy-N,N-dimethyl-3-phenylmethoxypropan-2-amine (PubChem CID 123394130) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 1-methoxy-N,N-dimethyl-3-phenylmethoxypropan-2-amine.
| Compound Name | 1-methoxy-N,N-dimethyl-3-phenylmethoxypropan-2-amine |
|---|---|
| PubChem CID | 123394130 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 1-methoxy-N,N-dimethyl-3-phenylmethoxypropan-2-amine |
| SMILES | COCC(COCc1ccccc1)N(C)C |
| InChI | InChI=1S/C13H21NO2/c1-14(2)13(10-15-3)11-16-9-12-7-5-4-6-8-12/h4-8,13H,9-11H2,1-3H3 |
| InChIKey | ROZDLMPIBHEJAE-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |