C21H32O — CID 101088231
[(2S,3E)-2-methyl-3-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]propoxy]methylbenzene (PubChem CID 101088231) has the molecular formula C21H32O and a molecular weight of 300.49 g/mol. Its IUPAC name is [(2S,3E)-2-methyl-3-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]propoxy]methylbenzene.
| Compound Name | [(2S,3E)-2-methyl-3-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]propoxy]methylbenzene |
|---|---|
| PubChem CID | 101088231 |
| Molecular Formula | C21H32O |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | [(2S,3E)-2-methyl-3-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]propoxy]methylbenzene |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C/C1=C\[C@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C21H32O/c1-16(2)21-11-10-17(3)12-20(21)13-18(4)14-22-15-19-8-6-5-7-9-19/h5-9,13,16-18,21H,10-12,14-15H2,1-4H3/b20-13+/t17-,18+,21+/m1/s1 |
| InChIKey | PQOIBZNSDYZPHW-HKENKKDJSA-N |
| XLogP | 5.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|