C24H40Si — CID 134903317
[(1E,2R)-3,3-dimethyl-1-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]butan-2-yl]-dimethyl-phenylsilane (PubChem CID 134903317) has the molecular formula C24H40Si and a molecular weight of 356.67 g/mol. Its IUPAC name is [(1E,2R)-3,3-dimethyl-1-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]butan-2-yl]-dimethyl-phenylsilane.
| Compound Name | [(1E,2R)-3,3-dimethyl-1-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]butan-2-yl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 134903317 |
| Molecular Formula | C24H40Si |
| Molecular Weight | 356.67 g/mol |
| Exact Mass | 356.29 |
| IUPAC Name | [(1E,2R)-3,3-dimethyl-1-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]butan-2-yl]-dimethyl-phenylsilane |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C/C1=C\[C@H](C(C)(C)C)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C24H40Si/c1-18(2)22-15-14-19(3)16-20(22)17-23(24(4,5)6)25(7,8)21-12-10-9-11-13-21/h9-13,17-19,22-23H,14-16H2,1-8H3/b20-17+/t19-,22+,23-/m1/s1 |
| InChIKey | UALZEBWEDRPAGN-YASKEUJTSA-N |
| XLogP | 7.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.67 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|