C28H40OSi — CID 134903403
dimethyl-[(1E,2R)-1-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]-3-phenylmethoxypropan-2-yl]-phenylsilane (PubChem CID 134903403) has the molecular formula C28H40OSi and a molecular weight of 420.71 g/mol. Its IUPAC name is dimethyl-[(1E,2R)-1-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]-3-phenylmethoxypropan-2-yl]-phenylsilane.
| Compound Name | dimethyl-[(1E,2R)-1-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]-3-phenylmethoxypropan-2-yl]-phenylsilane |
|---|---|
| PubChem CID | 134903403 |
| Molecular Formula | C28H40OSi |
| Molecular Weight | 420.71 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | dimethyl-[(1E,2R)-1-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]-3-phenylmethoxypropan-2-yl]-phenylsilane |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C/C1=C\[C@H](COCc1ccccc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C28H40OSi/c1-22(2)28-17-16-23(3)18-25(28)19-27(21-29-20-24-12-8-6-9-13-24)30(4,5)26-14-10-7-11-15-26/h6-15,19,22-23,27-28H,16-18,20-21H2,1-5H3/b25-19+/t23-,27-,28+/m1/s1 |
| InChIKey | CLPRVCNAWYNTHC-VNDYORBYSA-N |
| XLogP | 7.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.71 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|