C16H24O3 — CID 163402353
(2S)-2-methyl-5-[(2S)-1-phenylmethoxypropan-2-yl]oxyoxane (PubChem CID 163402353) has the molecular formula C16H24O3 and a molecular weight of 264.37 g/mol. Its IUPAC name is (2S)-2-methyl-5-[(2S)-1-phenylmethoxypropan-2-yl]oxyoxane.
| Compound Name | (2S)-2-methyl-5-[(2S)-1-phenylmethoxypropan-2-yl]oxyoxane |
|---|---|
| PubChem CID | 163402353 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (2S)-2-methyl-5-[(2S)-1-phenylmethoxypropan-2-yl]oxyoxane |
| SMILES | C[C@H]1CCC(O[C@@H](C)COCc2ccccc2)CO1 |
| InChI | InChI=1S/C16H24O3/c1-13-8-9-16(12-18-13)19-14(2)10-17-11-15-6-4-3-5-7-15/h3-7,13-14,16H,8-12H2,1-2H3/t13-,14-,16?/m0/s1 |
| InChIKey | GMKYNKNKOHZLQJ-ADTLFGHVSA-N |
| XLogP | 3.18 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |