C19H34 — CID 15357315
trans-(1S,2E,4R)-2-[(2R)-2-cyclohexylpropylidene]-4-methyl-1-propan-2-ylcyclohexane (PubChem CID 15357315) has the molecular formula C19H34 and a molecular weight of 262.48 g/mol. Its IUPAC name is trans-(1S,2E,4R)-2-[(2R)-2-cyclohexylpropylidene]-4-methyl-1-propan-2-ylcyclohexane.
| Compound Name | trans-(1S,2E,4R)-2-[(2R)-2-cyclohexylpropylidene]-4-methyl-1-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 15357315 |
| Molecular Formula | C19H34 |
| Molecular Weight | 262.48 g/mol |
| Exact Mass | 262.27 |
| IUPAC Name | trans-(1S,2E,4R)-2-[(2R)-2-cyclohexylpropylidene]-4-methyl-1-propan-2-ylcyclohexane |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C/C1=C\[C@H](C)C1CCCCC1 |
| InChI | InChI=1S/C19H34/c1-14(2)19-11-10-15(3)12-18(19)13-16(4)17-8-6-5-7-9-17/h13-17,19H,5-12H2,1-4H3/b18-13+/t15-,16+,19+/m1/s1 |
| InChIKey | ISWVUBFCHVKUAD-YUYNLEIKSA-N |
| XLogP | 6.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.48 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|