C10H19NO — CID 130756041
N-[(2R,5R)-5-methyl-2-propan-2-ylcyclohexylidene]hydroxylamine (PubChem CID 130756041) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is N-[(2R,5R)-5-methyl-2-propan-2-ylcyclohexylidene]hydroxylamine.
| Compound Name | N-[(2R,5R)-5-methyl-2-propan-2-ylcyclohexylidene]hydroxylamine |
|---|---|
| PubChem CID | 130756041 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | N-[(2R,5R)-5-methyl-2-propan-2-ylcyclohexylidene]hydroxylamine |
| SMILES | CC(C)[C@H]1CC[C@@H](C)CC1=NO |
| InChI | InChI=1S/C10H19NO/c1-7(2)9-5-4-8(3)6-10(9)11-12/h7-9,12H,4-6H2,1-3H3/t8-,9-/m1/s1 |
| InChIKey | XJKYDNDJFRDNHX-RKDXNWHRSA-N |
| XLogP | 2.91 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|