C16H23N3O — CID 9059884
N-[(Z)-[(2S,5S)-5-methyl-2-propan-2-ylcyclohexylidene]amino]pyridine-3-carboxamide (PubChem CID 9059884) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is N-[(Z)-[(2S,5S)-5-methyl-2-propan-2-ylcyclohexylidene]amino]pyridine-3-carboxamide.
| Compound Name | N-[(Z)-[(2S,5S)-5-methyl-2-propan-2-ylcyclohexylidene]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 9059884 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | N-[(Z)-[(2S,5S)-5-methyl-2-propan-2-ylcyclohexylidene]amino]pyridine-3-carboxamide |
| SMILES | CC(C)[C@@H]1CC[C@H](C)C/C1=N/NC(=O)c1cccnc1 |
| InChI | InChI=1S/C16H23N3O/c1-11(2)14-7-6-12(3)9-15(14)18-19-16(20)13-5-4-8-17-10-13/h4-5,8,10-12,14H,6-7,9H2,1-3H3,(H,19,20)/b18-15-/t12-,14-/m0/s1 |
| InChIKey | YASWBDCHUFYQGJ-IQBXMYBCSA-N |
| XLogP | 3.26 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|