C18H27N — CID 10868949
trans-(2S,5R)-5-methyl-N-[(1R)-1-phenylethyl]-2-propan-2-ylcyclohexan-1-imine (PubChem CID 10868949) has the molecular formula C18H27N and a molecular weight of 257.42 g/mol. Its IUPAC name is trans-(2S,5R)-5-methyl-N-[(1R)-1-phenylethyl]-2-propan-2-ylcyclohexan-1-imine.
| Compound Name | trans-(2S,5R)-5-methyl-N-[(1R)-1-phenylethyl]-2-propan-2-ylcyclohexan-1-imine |
|---|---|
| PubChem CID | 10868949 |
| Molecular Formula | C18H27N |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | trans-(2S,5R)-5-methyl-N-[(1R)-1-phenylethyl]-2-propan-2-ylcyclohexan-1-imine |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C/C1=N\[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C18H27N/c1-13(2)17-11-10-14(3)12-18(17)19-15(4)16-8-6-5-7-9-16/h5-9,13-15,17H,10-12H2,1-4H3/b19-18+/t14-,15-,17+/m1/s1 |
| InChIKey | CWARMCQOPCELNM-HWRWJAFMSA-N |
| XLogP | 5.28 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|