C41H48O5 — CID 100933382
2-[(1E,9S,14R)-9,14-dihydroxy-14-(methoxymethyl)-3,10-dimethyl-6-tricyclo[9.3.0.03,7]tetradeca-1,6-dienyl]propyl 4-pyren-1-ylbutanoate (PubChem CID 100933382) has the molecular formula C41H48O5 and a molecular weight of 620.83 g/mol. Its IUPAC name is 2-[(1E,9S,14R)-9,14-dihydroxy-14-(methoxymethyl)-3,10-dimethyl-6-tricyclo[9.3.0.03,7]tetradeca-1,6-dienyl]propyl 4-pyren-1-ylbutanoate.
| Compound Name | 2-[(1E,9S,14R)-9,14-dihydroxy-14-(methoxymethyl)-3,10-dimethyl-6-tricyclo[9.3.0.03,7]tetradeca-1,6-dienyl]propyl 4-pyren-1-ylbutanoate |
|---|---|
| PubChem CID | 100933382 |
| Molecular Formula | C41H48O5 |
| Molecular Weight | 620.83 g/mol |
| Exact Mass | 620.35 |
| IUPAC Name | 2-[(1E,9S,14R)-9,14-dihydroxy-14-(methoxymethyl)-3,10-dimethyl-6-tricyclo[9.3.0.03,7]tetradeca-1,6-dienyl]propyl 4-pyren-1-ylbutanoate |
| SMILES | COC[C@@]1(O)CCC2/C1=C\C1(C)CCC(C(C)COC(=O)CCCc3ccc4ccc5cccc6ccc3c4c56)=C1C[C@H](O)C2C |
| InChI | InChI=1S/C41H48O5/c1-25(31-17-19-40(3)22-35-32(18-20-41(35,44)24-45-4)26(2)36(42)21-34(31)40)23-46-37(43)10-6-7-27-11-12-30-14-13-28-8-5-9-29-15-16-33(27)39(30)38(28)29/h5,8-9,11-16,22,25-26,32,36,42,44H,6-7,10,17-21,23-24H2,1-4H3/b35-22+/t25?,26?,32?,36-,40?,41-/m0/s1 |
| InChIKey | TYDGKFBYLGHHKR-VFDCVVDTSA-N |
| XLogP | 8.30 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.83 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|