C43H34O6 — CID 122378859
[(4R,5R)-2,2-dimethyl-5-[(2-pyren-1-ylacetyl)oxymethyl]-1,3-dioxolan-4-yl]methyl 2-pyren-1-ylacetate (PubChem CID 122378859) has the molecular formula C43H34O6 and a molecular weight of 646.74 g/mol. Its IUPAC name is [(4R,5R)-2,2-dimethyl-5-[(2-pyren-1-ylacetyl)oxymethyl]-1,3-dioxolan-4-yl]methyl 2-pyren-1-ylacetate.
| Compound Name | [(4R,5R)-2,2-dimethyl-5-[(2-pyren-1-ylacetyl)oxymethyl]-1,3-dioxolan-4-yl]methyl 2-pyren-1-ylacetate |
|---|---|
| PubChem CID | 122378859 |
| Molecular Formula | C43H34O6 |
| Molecular Weight | 646.74 g/mol |
| Exact Mass | 646.24 |
| IUPAC Name | [(4R,5R)-2,2-dimethyl-5-[(2-pyren-1-ylacetyl)oxymethyl]-1,3-dioxolan-4-yl]methyl 2-pyren-1-ylacetate |
| SMILES | CC1(C)O[C@H](COC(=O)Cc2ccc3ccc4cccc5ccc2c3c45)[C@@H](COC(=O)Cc2ccc3ccc4cccc5ccc2c3c45)O1 |
| InChI | InChI=1S/C43H34O6/c1-43(2)48-35(23-46-37(44)21-31-15-13-29-11-9-25-5-3-7-27-17-19-33(31)41(29)39(25)27)36(49-43)24-47-38(45)22-32-16-14-30-12-10-26-6-4-8-28-18-20-34(32)42(30)40(26)28/h3-20,35-36H,21-24H2,1-2H3/t35-,36-/m1/s1 |
| InChIKey | UJFBWFDGLGNVIT-LQFQNGICSA-N |
| XLogP | 8.87 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.74 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|