C23H16O4 — CID 144743584
(2,5-dioxocyclopentyl) 2-pyren-1-ylacetate (PubChem CID 144743584) has the molecular formula C23H16O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is (2,5-dioxocyclopentyl) 2-pyren-1-ylacetate.
| Compound Name | (2,5-dioxocyclopentyl) 2-pyren-1-ylacetate |
|---|---|
| PubChem CID | 144743584 |
| Molecular Formula | C23H16O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | (2,5-dioxocyclopentyl) 2-pyren-1-ylacetate |
| SMILES | O=C(Cc1ccc2ccc3cccc4ccc1c2c34)OC1C(=O)CCC1=O |
| InChI | InChI=1S/C23H16O4/c24-18-10-11-19(25)23(18)27-20(26)12-16-7-6-15-5-4-13-2-1-3-14-8-9-17(16)22(15)21(13)14/h1-9,23H,10-12H2 |
| InChIKey | CZZXGDGBGJHPKV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|