About [4-[(4-aminophenyl)diazenyl]phenyl] 4-pyren-1-ylbutanoate
[4-[(4-aminophenyl)diazenyl]phenyl] 4-pyren-1-ylbutanoate (PubChem CID 102340429) has the molecular formula C32H25N3O2
and a molecular weight of 483.57 g/mol. Its IUPAC name is [4-[(4-aminophenyl)diazenyl]phenyl] 4-pyren-1-ylbutanoate.
Molecular Properties
| Compound Name | [4-[(4-aminophenyl)diazenyl]phenyl] 4-pyren-1-ylbutanoate |
| PubChem CID | 102340429 |
| Molecular Formula | C32H25N3O2 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | [4-[(4-aminophenyl)diazenyl]phenyl] 4-pyren-1-ylbutanoate |
| SMILES | Nc1ccc(/N=N/c2ccc(OC(=O)CCCc3ccc4ccc5cccc6ccc3c4c56)cc2)cc1 |
| InChI | InChI=1S/C32H25N3O2/c33-25-12-14-26(15-13-25)34-35-27-16-18-28(19-17-27)37-30(36)6-2-3-21-7-8-24-10-9-22-4-1-5-23-11-20-29(21)32(24)31(22)23/h1,4-5,7-20H,2-3,6,33H2/b35-34+ |
| InChIKey | QOZRHHLGXIPNBQ-XAHDOWKMSA-N |
| XLogP | 8.51 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[(4-aminophenyl)diazenyl]phenyl] 4-pyren-1-ylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(4-aminophenyl)diazenyl]phenyl] 4-pyren-1-ylbutanoate?
The IUPAC name of [4-[(4-aminophenyl)diazenyl]phenyl] 4-pyren-1-ylbutanoate (CID 102340429) is [4-[(4-aminophenyl)diazenyl]phenyl] 4-pyren-1-ylbutanoate.
What is the SMILES notation for [4-[(4-aminophenyl)diazenyl]phenyl] 4-pyren-1-ylbutanoate?
The canonical SMILES for [4-[(4-aminophenyl)diazenyl]phenyl] 4-pyren-1-ylbutanoate is Nc1ccc(/N=N/c2ccc(OC(=O)CCCc3ccc4ccc5cccc6ccc3c4c56)cc2)cc1.
What is the InChIKey of [4-[(4-aminophenyl)diazenyl]phenyl] 4-pyren-1-ylbutanoate?
The InChIKey is QOZRHHLGXIPNBQ-XAHDOWKMSA-N. The full InChI is InChI=1S/C32H25N3O2/c33-25-12-14-26(15-13-25)34-35-27-16-18-28(19-17-27)37-30(36)6-2-3-21-7-8-24-10-9-22-4-1-5-23-11-20-29(21)32(24)31(22)23/h1,4-5,7-20H,2-3,6,33H2/b35-34+.
What are the key properties of [4-[(4-aminophenyl)diazenyl]phenyl] 4-pyren-1-ylbutanoate?
[4-[(4-aminophenyl)diazenyl]phenyl] 4-pyren-1-ylbutanoate has a molecular weight of 483.57 g/mol, XLogP of 8.51, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(4-aminophenyl)diazenyl]phenyl] 4-pyren-1-ylbutanoate is sourced from PubChem (CID 102340429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).