C61H75NO7P+ — CID 100983692
3-[[(2R)-2,3-bis(10-pyren-1-yldecanoyloxy)propoxy]-hydroxy-oxidophosphaniumyl]propyl-trimethylazanium (PubChem CID 100983692) has the molecular formula C61H75NO7P+ and a molecular weight of 965.25 g/mol. Its IUPAC name is 3-[[(2R)-2,3-bis(10-pyren-1-yldecanoyloxy)propoxy]-hydroxy-oxidophosphaniumyl]propyl-trimethylazanium.
| Compound Name | 3-[[(2R)-2,3-bis(10-pyren-1-yldecanoyloxy)propoxy]-hydroxy-oxidophosphaniumyl]propyl-trimethylazanium |
|---|---|
| PubChem CID | 100983692 |
| Molecular Formula | C61H75NO7P+ |
| Molecular Weight | 965.25 g/mol |
| Exact Mass | 964.53 |
| IUPAC Name | 3-[[(2R)-2,3-bis(10-pyren-1-yldecanoyloxy)propoxy]-hydroxy-oxidophosphaniumyl]propyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCC[P+]([O-])(O)OC[C@@H](COC(=O)CCCCCCCCCc1ccc2ccc3cccc4ccc1c2c34)OC(=O)CCCCCCCCCc1ccc2ccc3cccc4ccc1c2c34 |
| InChI | InChI=1S/C61H74NO7P/c1-62(2,3)41-20-42-70(65,66)68-44-53(69-57(64)28-17-13-9-5-7-11-15-22-46-30-32-52-36-34-48-24-19-26-50-38-40-55(46)61(52)59(48)50)43-67-56(63)27-16-12-8-4-6-10-14-21-45-29-31-51-35-33-47-23-18-25-49-37-39-54(45)60(51)58(47)49/h18-19,23-26,29-40,53H,4-17,20-22,27-28,41-44H2,1-3H3/p+1/t53-/m1/s1 |
| InChIKey | HPSQLHZSWUSVQU-IONAWPRUSA-O |
| XLogP | 14.19 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 965.25 |
| LogP ≤ 5 | 14.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|