C49H49IN2O5 — CID 10724320
2-[[(3S)-3,4-bis(4-pyren-1-ylbutanoyloxy)butanoyl]amino]ethyl-trimethylazanium iodide (PubChem CID 10724320) has the molecular formula C49H49IN2O5 and a molecular weight of 872.84 g/mol. Its IUPAC name is 2-[[(3S)-3,4-bis(4-pyren-1-ylbutanoyloxy)butanoyl]amino]ethyl-trimethylazanium iodide.
| Compound Name | 2-[[(3S)-3,4-bis(4-pyren-1-ylbutanoyloxy)butanoyl]amino]ethyl-trimethylazanium iodide |
|---|---|
| PubChem CID | 10724320 |
| Molecular Formula | C49H49IN2O5 |
| Molecular Weight | 872.84 g/mol |
| Exact Mass | 872.27 |
| IUPAC Name | 2-[[(3S)-3,4-bis(4-pyren-1-ylbutanoyloxy)butanoyl]amino]ethyl-trimethylazanium iodide |
| SMILES | C[N+](C)(C)CCNC(=O)C[C@@H](COC(=O)CCCc1ccc2ccc3cccc4ccc1c2c34)OC(=O)CCCc1ccc2ccc3cccc4ccc1c2c34.[I-] |
| InChI | InChI=1S/C49H48N2O5.HI/c1-51(2,3)29-28-50-43(52)30-40(56-45(54)15-7-9-33-17-19-39-23-21-35-11-5-13-37-25-27-42(33)49(39)47(35)37)31-55-44(53)14-6-8-32-16-18-38-22-20-34-10-4-12-36-24-26-41(32)48(38)46(34)36;/h4-5,10-13,16-27,40H,6-9,14-15,28-31H2,1-3H3;1H/t40-;/m0./s1 |
| InChIKey | BMJCETCPVNDAPG-LMDYQTDMSA-N |
| XLogP | 6.50 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.84 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|