C15H22O3 — CID 101488072
(1S,4R,8R,13S)-8-hydroxy-1,5,5-trimethyl-6-oxatricyclo[6.3.2.04,13]tridec-10-en-9-one (PubChem CID 101488072) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (1S,4R,8R,13S)-8-hydroxy-1,5,5-trimethyl-6-oxatricyclo[6.3.2.04,13]tridec-10-en-9-one.
| Compound Name | (1S,4R,8R,13S)-8-hydroxy-1,5,5-trimethyl-6-oxatricyclo[6.3.2.04,13]tridec-10-en-9-one |
|---|---|
| PubChem CID | 101488072 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (1S,4R,8R,13S)-8-hydroxy-1,5,5-trimethyl-6-oxatricyclo[6.3.2.04,13]tridec-10-en-9-one |
| SMILES | CC1(C)OC[C@@]2(O)C(=O)C=C[C@@]3(C)CC[C@@H]1[C@@H]2C3 |
| InChI | InChI=1S/C15H22O3/c1-13(2)10-4-6-14(3)7-5-12(16)15(17,9-18-13)11(10)8-14/h5,7,10-11,17H,4,6,8-9H2,1-3H3/t10-,11+,14-,15+/m1/s1 |
| InChIKey | JUCOOLNFGCYGOH-BVIHXZOGSA-N |
| XLogP | 2.09 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |