C16H24O3 — CID 11844449
(1S,8R,13S)-8-methoxy-1,5,5-trimethyl-6-oxatricyclo[6.3.2.04,13]tridec-10-en-9-one (PubChem CID 11844449) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is (1S,8R,13S)-8-methoxy-1,5,5-trimethyl-6-oxatricyclo[6.3.2.04,13]tridec-10-en-9-one.
| Compound Name | (1S,8R,13S)-8-methoxy-1,5,5-trimethyl-6-oxatricyclo[6.3.2.04,13]tridec-10-en-9-one |
|---|---|
| PubChem CID | 11844449 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (1S,8R,13S)-8-methoxy-1,5,5-trimethyl-6-oxatricyclo[6.3.2.04,13]tridec-10-en-9-one |
| SMILES | CO[C@]12COC(C)(C)C3CC[C@](C)(C=CC1=O)C[C@@H]32 |
| InChI | InChI=1S/C16H24O3/c1-14(2)11-5-7-15(3)8-6-13(17)16(18-4,10-19-14)12(11)9-15/h6,8,11-12H,5,7,9-10H2,1-4H3/t11?,12-,15+,16-/m0/s1 |
| InChIKey | ANZVOFKLXQQWOO-GVLGWVKGSA-N |
| XLogP | 2.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |