C29H35NO3Si — CID 101488799
(1R,2S,9R)-9-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-oxa-10-azatricyclo[8.4.0.02,6]tetradeca-5,7-dien-4-one (PubChem CID 101488799) has the molecular formula C29H35NO3Si and a molecular weight of 473.69 g/mol. Its IUPAC name is (1R,2S,9R)-9-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-oxa-10-azatricyclo[8.4.0.02,6]tetradeca-5,7-dien-4-one.
| Compound Name | (1R,2S,9R)-9-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-oxa-10-azatricyclo[8.4.0.02,6]tetradeca-5,7-dien-4-one |
|---|---|
| PubChem CID | 101488799 |
| Molecular Formula | C29H35NO3Si |
| Molecular Weight | 473.69 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | (1R,2S,9R)-9-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-oxa-10-azatricyclo[8.4.0.02,6]tetradeca-5,7-dien-4-one |
| SMILES | CC(C)(C)[Si](OC[C@H]1C=CC2=CC(=O)O[C@@H]2[C@H]2CCCCN12)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H35NO3Si/c1-29(2,3)34(24-12-6-4-7-13-24,25-14-8-5-9-15-25)32-21-23-18-17-22-20-27(31)33-28(22)26-16-10-11-19-30(23)26/h4-9,12-15,17-18,20,23,26,28H,10-11,16,19,21H2,1-3H3/t23-,26-,28+/m1/s1 |
| InChIKey | IQIMYHFSILXBBV-RJRADHEHSA-N |
| XLogP | 4.21 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.69 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|