C28H33NO3Si — CID 11496292
(1R,2R,9R)-9-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-oxa-10-azatricyclo[8.3.0.02,6]trideca-5,7-dien-4-one (PubChem CID 11496292) has the molecular formula C28H33NO3Si and a molecular weight of 459.66 g/mol. Its IUPAC name is (1R,2R,9R)-9-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-oxa-10-azatricyclo[8.3.0.02,6]trideca-5,7-dien-4-one.
| Compound Name | (1R,2R,9R)-9-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-oxa-10-azatricyclo[8.3.0.02,6]trideca-5,7-dien-4-one |
|---|---|
| PubChem CID | 11496292 |
| Molecular Formula | C28H33NO3Si |
| Molecular Weight | 459.66 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | (1R,2R,9R)-9-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-oxa-10-azatricyclo[8.3.0.02,6]trideca-5,7-dien-4-one |
| SMILES | CC(C)(C)[Si](OC[C@H]1C=CC2=CC(=O)O[C@H]2[C@H]2CCCN12)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H33NO3Si/c1-28(2,3)33(23-11-6-4-7-12-23,24-13-8-5-9-14-24)31-20-22-17-16-21-19-26(30)32-27(21)25-15-10-18-29(22)25/h4-9,11-14,16-17,19,22,25,27H,10,15,18,20H2,1-3H3/t22-,25-,27-/m1/s1 |
| InChIKey | MLOYAGQFVHBPOA-AVPJRLCVSA-N |
| XLogP | 3.82 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.66 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|