C32H43NO5Si — CID 11827746
methyl (2R,5S)-2-[5-[tert-butyl(diphenyl)silyl]oxypentyl]-5-[(2S)-4-methyl-5-oxo-2H-furan-2-yl]pyrrolidine-1-carboxylate (PubChem CID 11827746) has the molecular formula C32H43NO5Si and a molecular weight of 549.78 g/mol. Its IUPAC name is methyl (2R,5S)-2-[5-[tert-butyl(diphenyl)silyl]oxypentyl]-5-[(2S)-4-methyl-5-oxo-2H-furan-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | methyl (2R,5S)-2-[5-[tert-butyl(diphenyl)silyl]oxypentyl]-5-[(2S)-4-methyl-5-oxo-2H-furan-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11827746 |
| Molecular Formula | C32H43NO5Si |
| Molecular Weight | 549.78 g/mol |
| Exact Mass | 549.29 |
| IUPAC Name | methyl (2R,5S)-2-[5-[tert-butyl(diphenyl)silyl]oxypentyl]-5-[(2S)-4-methyl-5-oxo-2H-furan-2-yl]pyrrolidine-1-carboxylate |
| SMILES | COC(=O)N1[C@H](CCCCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC[C@H]1[C@@H]1C=C(C)C(=O)O1 |
| InChI | InChI=1S/C32H43NO5Si/c1-24-23-29(38-30(24)34)28-21-20-25(33(28)31(35)36-5)15-9-8-14-22-37-39(32(2,3)4,26-16-10-6-11-17-26)27-18-12-7-13-19-27/h6-7,10-13,16-19,23,25,28-29H,8-9,14-15,20-22H2,1-5H3/t25-,28+,29+/m1/s1 |
| InChIKey | XDGGGLGSDQHRQI-IGBKUBFESA-N |
| XLogP | 5.59 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.78 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|