C26H33NO3Si — CID 10863026
(3S,8S,8aS)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-8-methoxy-2,3,8,8a-tetrahydro-1H-indolizin-5-one (PubChem CID 10863026) has the molecular formula C26H33NO3Si and a molecular weight of 435.64 g/mol. Its IUPAC name is (3S,8S,8aS)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-8-methoxy-2,3,8,8a-tetrahydro-1H-indolizin-5-one.
| Compound Name | (3S,8S,8aS)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-8-methoxy-2,3,8,8a-tetrahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 10863026 |
| Molecular Formula | C26H33NO3Si |
| Molecular Weight | 435.64 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | (3S,8S,8aS)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-8-methoxy-2,3,8,8a-tetrahydro-1H-indolizin-5-one |
| SMILES | CO[C@H]1C=CC(=O)N2[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)CC[C@@H]12 |
| InChI | InChI=1S/C26H33NO3Si/c1-26(2,3)31(21-11-7-5-8-12-21,22-13-9-6-10-14-22)30-19-20-15-16-23-24(29-4)17-18-25(28)27(20)23/h5-14,17-18,20,23-24H,15-16,19H2,1-4H3/t20-,23-,24-/m0/s1 |
| InChIKey | JDZKIWPQWXEMRH-OYDLWJJNSA-N |
| XLogP | 3.51 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.64 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|