C30H41NO5Si — CID 56955666
tert-butyl (2S,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(E)-3-methoxy-3-oxoprop-1-enyl]pyrrolidine-1-carboxylate (PubChem CID 56955666) has the molecular formula C30H41NO5Si and a molecular weight of 523.75 g/mol. Its IUPAC name is tert-butyl (2S,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(E)-3-methoxy-3-oxoprop-1-enyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(E)-3-methoxy-3-oxoprop-1-enyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 56955666 |
| Molecular Formula | C30H41NO5Si |
| Molecular Weight | 523.75 g/mol |
| Exact Mass | 523.28 |
| IUPAC Name | tert-butyl (2S,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(E)-3-methoxy-3-oxoprop-1-enyl]pyrrolidine-1-carboxylate |
| SMILES | COC(=O)/C=C/[C@@H]1CC[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H41NO5Si/c1-29(2,3)36-28(33)31-23(20-21-27(32)34-7)18-19-24(31)22-35-37(30(4,5)6,25-14-10-8-11-15-25)26-16-12-9-13-17-26/h8-17,20-21,23-24H,18-19,22H2,1-7H3/b21-20+/t23-,24-/m0/s1 |
| InChIKey | UUSCRQIAQSCIFM-HJWKJHNHSA-N |
| XLogP | 5.06 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.75 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|