C25H31NO2Si — CID 10873197
(3S,8aS)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3,6,8a-tetrahydro-1H-indolizin-5-one (PubChem CID 10873197) has the molecular formula C25H31NO2Si and a molecular weight of 405.61 g/mol. Its IUPAC name is (3S,8aS)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3,6,8a-tetrahydro-1H-indolizin-5-one.
| Compound Name | (3S,8aS)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3,6,8a-tetrahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 10873197 |
| Molecular Formula | C25H31NO2Si |
| Molecular Weight | 405.61 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | (3S,8aS)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3,6,8a-tetrahydro-1H-indolizin-5-one |
| SMILES | CC(C)(C)[Si](OC[C@@H]1CC[C@H]2C=CCC(=O)N12)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H31NO2Si/c1-25(2,3)29(22-12-6-4-7-13-22,23-14-8-5-9-15-23)28-19-21-18-17-20-11-10-16-24(27)26(20)21/h4-15,20-21H,16-19H2,1-3H3/t20-,21+/m1/s1 |
| InChIKey | XUINBCSPVJVYMD-RTWAWAEBSA-N |
| XLogP | 3.88 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.61 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|