C33H46F3NO3Si2 — CID 122390056
1-[(2S,6R,7aS)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-[tert-butyl(diphenyl)silyl]oxy-2,3,5,6,7,7a-hexahydroindol-1-yl]-2,2,2-trifluoroethanone (PubChem CID 122390056) has the molecular formula C33H46F3NO3Si2 and a molecular weight of 617.90 g/mol. Its IUPAC name is 1-[(2S,6R,7aS)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-[tert-butyl(diphenyl)silyl]oxy-2,3,5,6,7,7a-hexahydroindol-1-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[(2S,6R,7aS)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-[tert-butyl(diphenyl)silyl]oxy-2,3,5,6,7,7a-hexahydroindol-1-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 122390056 |
| Molecular Formula | C33H46F3NO3Si2 |
| Molecular Weight | 617.90 g/mol |
| Exact Mass | 617.30 |
| IUPAC Name | 1-[(2S,6R,7aS)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-[tert-butyl(diphenyl)silyl]oxy-2,3,5,6,7,7a-hexahydroindol-1-yl]-2,2,2-trifluoroethanone |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1CC2=CC[C@@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C[C@@H]2N1C(=O)C(F)(F)F |
| InChI | InChI=1S/C33H46F3NO3Si2/c1-31(2,3)41(7,8)39-23-25-21-24-19-20-26(22-29(24)37(25)30(38)33(34,35)36)40-42(32(4,5)6,27-15-11-9-12-16-27)28-17-13-10-14-18-28/h9-19,25-26,29H,20-23H2,1-8H3/t25-,26+,29-/m0/s1 |
| InChIKey | CYGOSNLXBONHOX-HFASVGIHSA-N |
| XLogP | 7.21 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.90 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|