C28H31NO4Si — CID 11540114
(1R,2R,9R)-9-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-oxa-10-azatricyclo[8.3.0.02,6]trideca-5,7-diene-4,11-dione (PubChem CID 11540114) has the molecular formula C28H31NO4Si and a molecular weight of 473.65 g/mol. Its IUPAC name is (1R,2R,9R)-9-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-oxa-10-azatricyclo[8.3.0.02,6]trideca-5,7-diene-4,11-dione.
| Compound Name | (1R,2R,9R)-9-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-oxa-10-azatricyclo[8.3.0.02,6]trideca-5,7-diene-4,11-dione |
|---|---|
| PubChem CID | 11540114 |
| Molecular Formula | C28H31NO4Si |
| Molecular Weight | 473.65 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | (1R,2R,9R)-9-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-oxa-10-azatricyclo[8.3.0.02,6]trideca-5,7-diene-4,11-dione |
| SMILES | CC(C)(C)[Si](OC[C@H]1C=CC2=CC(=O)O[C@H]2[C@H]2CCC(=O)N12)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H31NO4Si/c1-28(2,3)34(22-10-6-4-7-11-22,23-12-8-5-9-13-23)32-19-21-15-14-20-18-26(31)33-27(20)24-16-17-25(30)29(21)24/h4-15,18,21,24,27H,16-17,19H2,1-3H3/t21-,24-,27-/m1/s1 |
| InChIKey | XSTQINOIPJFBPV-GNMGOMLTSA-N |
| XLogP | 3.34 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.65 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|