C30H35NO4Si — CID 134848013
(5R)-1-[1-[tert-butyl(diphenyl)silyl]oxybut-3-en-2-yl]-5-[(2R)-3-ethenyl-5-oxo-2H-furan-2-yl]pyrrolidin-2-one (PubChem CID 134848013) has the molecular formula C30H35NO4Si and a molecular weight of 501.70 g/mol. Its IUPAC name is (5R)-1-[1-[tert-butyl(diphenyl)silyl]oxybut-3-en-2-yl]-5-[(2R)-3-ethenyl-5-oxo-2H-furan-2-yl]pyrrolidin-2-one.
| Compound Name | (5R)-1-[1-[tert-butyl(diphenyl)silyl]oxybut-3-en-2-yl]-5-[(2R)-3-ethenyl-5-oxo-2H-furan-2-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 134848013 |
| Molecular Formula | C30H35NO4Si |
| Molecular Weight | 501.70 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | (5R)-1-[1-[tert-butyl(diphenyl)silyl]oxybut-3-en-2-yl]-5-[(2R)-3-ethenyl-5-oxo-2H-furan-2-yl]pyrrolidin-2-one |
| SMILES | C=CC1=CC(=O)O[C@H]1[C@H]1CCC(=O)N1C(C=C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H35NO4Si/c1-6-22-20-28(33)35-29(22)26-18-19-27(32)31(26)23(7-2)21-34-36(30(3,4)5,24-14-10-8-11-15-24)25-16-12-9-13-17-25/h6-17,20,23,26,29H,1-2,18-19,21H2,3-5H3/t23?,26-,29-/m1/s1 |
| InChIKey | JBFNWGAYFFNHFC-STQDQYIESA-N |
| XLogP | 4.15 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.70 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|