C28H37NO4Si — CID 71732480
tert-butyl (E)-3-[(2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-oxopyrrolidin-1-yl]prop-2-enoate (PubChem CID 71732480) has the molecular formula C28H37NO4Si and a molecular weight of 479.69 g/mol. Its IUPAC name is tert-butyl (E)-3-[(2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-oxopyrrolidin-1-yl]prop-2-enoate.
| Compound Name | tert-butyl (E)-3-[(2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-oxopyrrolidin-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 71732480 |
| Molecular Formula | C28H37NO4Si |
| Molecular Weight | 479.69 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | tert-butyl (E)-3-[(2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-oxopyrrolidin-1-yl]prop-2-enoate |
| SMILES | CC(C)(C)OC(=O)/C=C/N1C(=O)CC[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H37NO4Si/c1-27(2,3)33-26(31)19-20-29-22(17-18-25(29)30)21-32-34(28(4,5)6,23-13-9-7-10-14-23)24-15-11-8-12-16-24/h7-16,19-20,22H,17-18,21H2,1-6H3/b20-19+/t22-/m0/s1 |
| InChIKey | IKJYMINIIKKKOL-PANRORFQSA-N |
| XLogP | 4.41 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.69 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|